About 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one
10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one (PubChem CID 5059220) has the molecular formula C21H12Cl2O
and a molecular weight of 351.23 g/mol. Its IUPAC name is 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one.
Molecular Properties
| Compound Name | 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one |
| PubChem CID | 5059220 |
| Molecular Formula | C21H12Cl2O |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one |
| SMILES | O=C1c2ccccc2C(=Cc2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C21H12Cl2O/c22-19-10-9-13(12-20(19)23)11-18-14-5-1-3-7-16(14)21(24)17-8-4-2-6-15(17)18/h1-12H |
| InChIKey | RLQCHEITEPTTMS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one?
The IUPAC name of 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one (CID 5059220) is 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one.
What is the SMILES notation for 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one?
The canonical SMILES for 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one is O=C1c2ccccc2C(=Cc2ccc(Cl)c(Cl)c2)c2ccccc21.
What is the InChIKey of 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one?
The InChIKey is RLQCHEITEPTTMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12Cl2O/c22-19-10-9-13(12-20(19)23)11-18-14-5-1-3-7-16(14)21(24)17-8-4-2-6-15(17)18/h1-12H.
What are the key properties of 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one?
10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one has a molecular weight of 351.23 g/mol, XLogP of 6.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[(3,4-dichlorophenyl)methylidene]anthracen-9-one is sourced from PubChem (CID 5059220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).