C13H21N5O5 — CID 505934
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(propylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 505934) has the molecular formula C13H21N5O5 and a molecular weight of 327.34 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(propylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(propylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 505934 |
| Molecular Formula | C13H21N5O5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(propylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCNC(=O)[C@@H]1OC(C(=O)O)=C[C@H](N=C(N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C13H21N5O5/c1-3-4-16-11(20)10-9(17-6(2)19)7(18-13(14)15)5-8(23-10)12(21)22/h5,7,9-10H,3-4H2,1-2H3,(H,16,20)(H,17,19)(H,21,22)(H4,14,15,18)/t7-,9+,10+/m0/s1 |
| InChIKey | IZQHJLQEZZNCJI-FXBDTBDDSA-N |
| XLogP | -1.97 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|