C12H19N5O5 — CID 505937
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 505937) has the molecular formula C12H19N5O5 and a molecular weight of 313.31 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 505937 |
| Molecular Formula | C12H19N5O5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1[C@@H](N=C(N)N)C=C(C(=O)O)O[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C12H19N5O5/c1-5(18)15-8-6(16-12(13)14)4-7(11(20)21)22-9(8)10(19)17(2)3/h4,6,8-9H,1-3H3,(H,15,18)(H,20,21)(H4,13,14,16)/t6-,8+,9+/m0/s1 |
| InChIKey | QYYCFCXQJFGQJQ-NBEYISGCSA-N |
| XLogP | -2.41 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|