C11H13N2O3- — CID 5059391
5-[(3-methyl-2-pyridinyl)amino]-5-oxopentanoate (PubChem CID 5059391) has the molecular formula C11H13N2O3- and a molecular weight of 221.24 g/mol. Its IUPAC name is 5-[(3-methyl-2-pyridinyl)amino]-5-oxopentanoate.
| Compound Name | 5-[(3-methyl-2-pyridinyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 5059391 |
| Molecular Formula | C11H13N2O3- |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 5-[(3-methyl-2-pyridinyl)amino]-5-oxopentanoate |
| SMILES | Cc1cccnc1NC(=O)CCCC(=O)[O-] |
| InChI | InChI=1S/C11H14N2O3/c1-8-4-3-7-12-11(8)13-9(14)5-2-6-10(15)16/h3-4,7H,2,5-6H2,1H3,(H,15,16)(H,12,13,14)/p-1 |
| InChIKey | PJICBMYEQGWUIH-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |