C16H27N5O5 — CID 505944
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dipropylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 505944) has the molecular formula C16H27N5O5 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dipropylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dipropylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 505944 |
| Molecular Formula | C16H27N5O5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dipropylcarbamoyl)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCN(CCC)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N=C(N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C16H27N5O5/c1-4-6-21(7-5-2)14(23)13-12(19-9(3)22)10(20-16(17)18)8-11(26-13)15(24)25/h8,10,12-13H,4-7H2,1-3H3,(H,19,22)(H,24,25)(H4,17,18,20)/t10-,12+,13+/m0/s1 |
| InChIKey | XIBPARAFOQGPJL-CYZMBNFOSA-N |
| XLogP | -0.85 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|