C15H21N3O5 — CID 506013
(2R,3R,4S)-3-acetamido-4-amino-2-[bis(prop-2-enyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 506013) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-amino-2-[bis(prop-2-enyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-amino-2-[bis(prop-2-enyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 506013 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-amino-2-[bis(prop-2-enyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C=CCN(CC=C)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C15H21N3O5/c1-4-6-18(7-5-2)14(20)13-12(17-9(3)19)10(16)8-11(23-13)15(21)22/h4-5,8,10,12-13H,1-2,6-7,16H2,3H3,(H,17,19)(H,21,22)/t10-,12+,13+/m0/s1 |
| InChIKey | JHKGUGIKUGELSW-CYZMBNFOSA-N |
| XLogP | -0.61 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|