About 4-carbamoylbenzoic acid
4-carbamoylbenzoic acid (PubChem CID 506057) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 4-carbamoylbenzoic acid.
Molecular Properties
| Compound Name | 4-carbamoylbenzoic acid |
| PubChem CID | 506057 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 4-carbamoylbenzoic acid |
| SMILES | NC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H7NO3/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| InChIKey | JMHSCWJIDIKGNZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-carbamoylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carbamoylbenzoic acid?
The IUPAC name of 4-carbamoylbenzoic acid (CID 506057) is 4-carbamoylbenzoic acid.
What is the SMILES notation for 4-carbamoylbenzoic acid?
The canonical SMILES for 4-carbamoylbenzoic acid is NC(=O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-carbamoylbenzoic acid?
The InChIKey is JMHSCWJIDIKGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H2,9,10)(H,11,12).
What are the key properties of 4-carbamoylbenzoic acid?
4-carbamoylbenzoic acid has a molecular weight of 165.15 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carbamoylbenzoic acid is sourced from PubChem (CID 506057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).