About 4-(2-aminoethyl)benzoic acid
4-(2-aminoethyl)benzoic acid (PubChem CID 506066) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)benzoic acid |
| PubChem CID | 506066 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4-(2-aminoethyl)benzoic acid |
| SMILES | NCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H11NO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4H,5-6,10H2,(H,11,12) |
| InChIKey | MRBFWTDIRYEDBQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminoethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)benzoic acid?
The IUPAC name of 4-(2-aminoethyl)benzoic acid (CID 506066) is 4-(2-aminoethyl)benzoic acid.
What is the SMILES notation for 4-(2-aminoethyl)benzoic acid?
The canonical SMILES for 4-(2-aminoethyl)benzoic acid is NCCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(2-aminoethyl)benzoic acid?
The InChIKey is MRBFWTDIRYEDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4H,5-6,10H2,(H,11,12).
What are the key properties of 4-(2-aminoethyl)benzoic acid?
4-(2-aminoethyl)benzoic acid has a molecular weight of 165.19 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)benzoic acid is sourced from PubChem (CID 506066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).