About 3-(aminomethyl)benzoic acid
3-(aminomethyl)benzoic acid (PubChem CID 506073) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-(aminomethyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(aminomethyl)benzoic acid |
| PubChem CID | 506073 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-(aminomethyl)benzoic acid |
| SMILES | NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H9NO2/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4H,5,9H2,(H,10,11) |
| InChIKey | GSWYUZQBLVUEPH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(aminomethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)benzoic acid?
The IUPAC name of 3-(aminomethyl)benzoic acid (CID 506073) is 3-(aminomethyl)benzoic acid.
What is the SMILES notation for 3-(aminomethyl)benzoic acid?
The canonical SMILES for 3-(aminomethyl)benzoic acid is NCc1cccc(C(=O)O)c1.
What is the InChIKey of 3-(aminomethyl)benzoic acid?
The InChIKey is GSWYUZQBLVUEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4H,5,9H2,(H,10,11).
What are the key properties of 3-(aminomethyl)benzoic acid?
3-(aminomethyl)benzoic acid has a molecular weight of 151.16 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)benzoic acid is sourced from PubChem (CID 506073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).