About [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate (PubChem CID 5061178) has the molecular formula C21H14ClF3N2O3
and a molecular weight of 434.80 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate |
| PubChem CID | 5061178 |
| Molecular Formula | C21H14ClF3N2O3 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate |
| SMILES | O=C(OC(C(=O)Nc1ccc(Cl)cc1C(F)(F)F)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C21H14ClF3N2O3/c22-15-6-7-17(16(12-15)21(23,24)25)27-19(28)18(13-4-2-1-3-5-13)30-20(29)14-8-10-26-11-9-14/h1-12,18H,(H,27,28) |
| InChIKey | VBEBAEUVJUOYFM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate?
The IUPAC name of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate (CID 5061178) is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate.
What is the SMILES notation for [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate?
The canonical SMILES for [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate is O=C(OC(C(=O)Nc1ccc(Cl)cc1C(F)(F)F)c1ccccc1)c1ccncc1.
What is the InChIKey of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate?
The InChIKey is VBEBAEUVJUOYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14ClF3N2O3/c22-15-6-7-17(16(12-15)21(23,24)25)27-19(28)18(13-4-2-1-3-5-13)30-20(29)14-8-10-26-11-9-14/h1-12,18H,(H,27,28).
What are the key properties of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate?
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate has a molecular weight of 434.80 g/mol, XLogP of 5.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] pyridine-4-carboxylate is sourced from PubChem (CID 5061178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).