C14H26N4O3 — CID 506139
trans-(3S,4R)-3-(1-acetamidopentyl)-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid (PubChem CID 506139) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is trans-(3S,4R)-3-(1-acetamidopentyl)-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(3S,4R)-3-(1-acetamidopentyl)-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 506139 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | trans-(3S,4R)-3-(1-acetamidopentyl)-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
| SMILES | CCCCC(NC(C)=O)[C@@H]1CC(C(=O)O)C[C@H]1N=C(N)N |
| InChI | InChI=1S/C14H26N4O3/c1-3-4-5-11(17-8(2)19)10-6-9(13(20)21)7-12(10)18-14(15)16/h9-12H,3-7H2,1-2H3,(H,17,19)(H,20,21)(H4,15,16,18)/t9?,10-,11?,12+/m0/s1 |
| InChIKey | FOEDJODWGAJPQM-POSLAHMBSA-N |
| XLogP | 0.43 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|