About N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide
N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 5061851) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide |
| PubChem CID | 5061851 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | COCCCNC(=O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H13N3O3S/c1-15-5-2-3-10-7(13)8(14)12-9-11-4-6-16-9/h4,6H,2-3,5H2,1H3,(H,10,13)(H,11,12,14) |
| InChIKey | NWLGDELFWODENJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide?
The IUPAC name of N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide (CID 5061851) is N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide.
What is the SMILES notation for N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide?
The canonical SMILES for N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide is COCCCNC(=O)C(=O)Nc1nccs1.
What is the InChIKey of N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide?
The InChIKey is NWLGDELFWODENJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-15-5-2-3-10-7(13)8(14)12-9-11-4-6-16-9/h4,6H,2-3,5H2,1H3,(H,10,13)(H,11,12,14).
What are the key properties of N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide?
N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide has a molecular weight of 243.29 g/mol, XLogP of 0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-N'-(1,3-thiazol-2-yl)oxamide is sourced from PubChem (CID 5061851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).