C33H23Br2Cl2FN2O6 — CID 5061859
6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5061859) has the molecular formula C33H23Br2Cl2FN2O6 and a molecular weight of 793.27 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5061859 |
| Molecular Formula | C33H23Br2Cl2FN2O6 |
| Molecular Weight | 793.27 g/mol |
| Exact Mass | 789.93 |
| IUPAC Name | 6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccccc5)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)c(Br)c(Br)c1O |
| InChI | InChI=1S/C33H23Br2Cl2FN2O6/c1-46-22-13-20(25(34)26(35)27(22)41)24-18-11-12-19-23(29(43)39(28(19)42)16-5-3-2-4-6-16)21(18)14-32(36)30(44)40(31(45)33(24,32)37)17-9-7-15(38)8-10-17/h2-11,13,19,21,23-24,41H,12,14H2,1H3 |
| InChIKey | UJNAGJTWECEOQG-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.27 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|