C23H19F4N3O4 — CID 506246
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2,2,2-trifluoroethoxy)-1H-indol-3-yl]ethane-1,2-dione (PubChem CID 506246) has the molecular formula C23H19F4N3O4 and a molecular weight of 477.41 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2,2,2-trifluoroethoxy)-1H-indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2,2,2-trifluoroethoxy)-1H-indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 506246 |
| Molecular Formula | C23H19F4N3O4 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(2,2,2-trifluoroethoxy)-1H-indol-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(OCC(F)(F)F)ccc(F)c12 |
| InChI | InChI=1S/C23H19F4N3O4/c24-16-6-7-17(34-13-23(25,26)27)19-18(16)15(12-28-19)20(31)22(33)30-10-8-29(9-11-30)21(32)14-4-2-1-3-5-14/h1-7,12,28H,8-11,13H2 |
| InChIKey | JEDLHCTUJDQYBZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|