C18H24N4O2S2 — CID 5063213
N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propanamide (PubChem CID 5063213) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propanamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propanamide |
|---|---|
| PubChem CID | 5063213 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)propanamide |
| SMILES | COc1ccc2nc(NC(=O)CCN3C(=S)NC(C)(C)CC3C)sc2c1 |
| InChI | InChI=1S/C18H24N4O2S2/c1-11-10-18(2,3)21-17(25)22(11)8-7-15(23)20-16-19-13-6-5-12(24-4)9-14(13)26-16/h5-6,9,11H,7-8,10H2,1-4H3,(H,21,25)(H,19,20,23) |
| InChIKey | HNGJZLKYBWGVDC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|