C18H16FN5O3 — CID 506360
1-(4-fluoro-1H-indol-3-yl)-2-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 506360) has the molecular formula C18H16FN5O3 and a molecular weight of 369.36 g/mol. Its IUPAC name is 1-(4-fluoro-1H-indol-3-yl)-2-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(4-fluoro-1H-indol-3-yl)-2-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 506360 |
| Molecular Formula | C18H16FN5O3 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1-(4-fluoro-1H-indol-3-yl)-2-[4-(1H-pyrazole-5-carbonyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccn[nH]2)CC1)c1c[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C18H16FN5O3/c19-12-2-1-3-13-15(12)11(10-20-13)16(25)18(27)24-8-6-23(7-9-24)17(26)14-4-5-21-22-14/h1-5,10,20H,6-9H2,(H,21,22) |
| InChIKey | JJOHWLBKNAWWLV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|