About 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene
1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene (PubChem CID 5063692) has the molecular formula C16H16Br2O4
and a molecular weight of 432.11 g/mol. Its IUPAC name is 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene |
| PubChem CID | 5063692 |
| Molecular Formula | C16H16Br2O4 |
| Molecular Weight | 432.11 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene |
| SMILES | COc1cc(Br)c(-c2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C16H16Br2O4/c1-19-13-5-9(11(17)7-15(13)21-3)10-6-14(20-2)16(22-4)8-12(10)18/h5-8H,1-4H3 |
| InChIKey | USDDSYZWAYRCCZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.11 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene?
The IUPAC name of 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene (CID 5063692) is 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene.
What is the SMILES notation for 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene?
The canonical SMILES for 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene is COc1cc(Br)c(-c2cc(OC)c(OC)cc2Br)cc1OC.
What is the InChIKey of 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene?
The InChIKey is USDDSYZWAYRCCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Br2O4/c1-19-13-5-9(11(17)7-15(13)21-3)10-6-14(20-2)16(22-4)8-12(10)18/h5-8H,1-4H3.
What are the key properties of 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene?
1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene has a molecular weight of 432.11 g/mol, XLogP of 4.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(2-bromo-4,5-dimethoxyphenyl)-4,5-dimethoxybenzene is sourced from PubChem (CID 5063692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).