About N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide
N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 5063817) has the molecular formula C17H16BrN3O2
and a molecular weight of 374.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide |
| PubChem CID | 5063817 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)Nc3cccc(Br)c3)o2)n1 |
| InChI | InChI=1S/C17H16BrN3O2/c1-11-8-12(2)21(20-11)10-15-6-7-16(23-15)17(22)19-14-5-3-4-13(18)9-14/h3-9H,10H2,1-2H3,(H,19,22) |
| InChIKey | HJESFMONCIKKSO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide?
The IUPAC name of N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide (CID 5063817) is N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide.
What is the SMILES notation for N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide?
The canonical SMILES for N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide is Cc1cc(C)n(Cc2ccc(C(=O)Nc3cccc(Br)c3)o2)n1.
What is the InChIKey of N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide?
The InChIKey is HJESFMONCIKKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrN3O2/c1-11-8-12(2)21(20-11)10-15-6-7-16(23-15)17(22)19-14-5-3-4-13(18)9-14/h3-9H,10H2,1-2H3,(H,19,22).
What are the key properties of N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide?
N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide has a molecular weight of 374.24 g/mol, XLogP of 4.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)-5-[(3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxamide is sourced from PubChem (CID 5063817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).