C22H24N4O5S — CID 5063823
(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 5063823) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 5063823 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | Cc1sc2nc(COC(=O)c3ccc(N4CCCC(C)C4)c([N+](=O)[O-])c3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C22H24N4O5S/c1-12-5-4-8-25(10-12)16-7-6-15(9-17(16)26(29)30)22(28)31-11-18-23-20(27)19-13(2)14(3)32-21(19)24-18/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,23,24,27) |
| InChIKey | ZDUYNBHHQXJOBI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|