C22H22BrN3O6 — CID 506394
1-[(2R)-4-(5-bromofuran-2-carbonyl)-2-methylpiperazin-1-yl]-2-(4,7-dimethoxy-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 506394) has the molecular formula C22H22BrN3O6 and a molecular weight of 504.34 g/mol. Its IUPAC name is 1-[(2R)-4-(5-bromofuran-2-carbonyl)-2-methylpiperazin-1-yl]-2-(4,7-dimethoxy-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-(5-bromofuran-2-carbonyl)-2-methylpiperazin-1-yl]-2-(4,7-dimethoxy-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 506394 |
| Molecular Formula | C22H22BrN3O6 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 1-[(2R)-4-(5-bromofuran-2-carbonyl)-2-methylpiperazin-1-yl]-2-(4,7-dimethoxy-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | COc1ccc(OC)c2c(C(=O)C(=O)N3CCN(C(=O)c4ccc(Br)o4)C[C@H]3C)c[nH]c12 |
| InChI | InChI=1S/C22H22BrN3O6/c1-12-11-25(21(28)16-6-7-17(23)32-16)8-9-26(12)22(29)20(27)13-10-24-19-15(31-3)5-4-14(30-2)18(13)19/h4-7,10,12,24H,8-9,11H2,1-3H3/t12-/m1/s1 |
| InChIKey | FOOOKSNNLVUHTM-GFCCVEGCSA-N |
| XLogP | 3.10 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|