C16H18N2O — CID 5064165
1,15,15-trimethyl-10-oxido-3-aza-10-azoniatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene (PubChem CID 5064165) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,15,15-trimethyl-10-oxido-3-aza-10-azoniatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene.
| Compound Name | 1,15,15-trimethyl-10-oxido-3-aza-10-azoniatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 5064165 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1,15,15-trimethyl-10-oxido-3-aza-10-azoniatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene |
| SMILES | CC12CCC(c3c1nc1ccccc1[n+]3[O-])C2(C)C |
| InChI | InChI=1S/C16H18N2O/c1-15(2)10-8-9-16(15,3)14-13(10)18(19)12-7-5-4-6-11(12)17-14/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | KUOCNEWJDWSGGC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|