C20H21N5O6 — CID 5064357
oxolan-2-ylmethyl 8-carbamoyl-2-methyl-4-(2-nitrophenyl)-1,4-dihydroimidazo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 5064357) has the molecular formula C20H21N5O6 and a molecular weight of 427.42 g/mol. Its IUPAC name is oxolan-2-ylmethyl 8-carbamoyl-2-methyl-4-(2-nitrophenyl)-1,4-dihydroimidazo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | oxolan-2-ylmethyl 8-carbamoyl-2-methyl-4-(2-nitrophenyl)-1,4-dihydroimidazo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 5064357 |
| Molecular Formula | C20H21N5O6 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | oxolan-2-ylmethyl 8-carbamoyl-2-methyl-4-(2-nitrophenyl)-1,4-dihydroimidazo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCC2CCCO2)C(c2ccccc2[N+](=O)[O-])n2cnc(C(N)=O)c2N1 |
| InChI | InChI=1S/C20H21N5O6/c1-11-15(20(27)31-9-12-5-4-8-30-12)17(13-6-2-3-7-14(13)25(28)29)24-10-22-16(18(21)26)19(24)23-11/h2-3,6-7,10,12,17,23H,4-5,8-9H2,1H3,(H2,21,26) |
| InChIKey | ZGXJQYYNKIWLEG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|