C24H30N2O3 — CID 5064989
2-[6-(1,3-benzodioxol-5-yl)-2-hexyl-2-methyl-3,4-dihydro-1H-pyrimidin-4-yl]phenol (PubChem CID 5064989) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yl)-2-hexyl-2-methyl-3,4-dihydro-1H-pyrimidin-4-yl]phenol.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yl)-2-hexyl-2-methyl-3,4-dihydro-1H-pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 5064989 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yl)-2-hexyl-2-methyl-3,4-dihydro-1H-pyrimidin-4-yl]phenol |
| SMILES | CCCCCCC1(C)NC(c2ccc3c(c2)OCO3)=CC(c2ccccc2O)N1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-4-5-8-13-24(2)25-19(17-11-12-22-23(14-17)29-16-28-22)15-20(26-24)18-9-6-7-10-21(18)27/h6-7,9-12,14-15,20,25-27H,3-5,8,13,16H2,1-2H3 |
| InChIKey | CJMXYIBMAQBFBJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|