C21H25NO4 — CID 5065242
propyl 2-[4-[(2,4-dimethylphenyl)carbamoyl]phenoxy]propanoate (PubChem CID 5065242) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is propyl 2-[4-[(2,4-dimethylphenyl)carbamoyl]phenoxy]propanoate.
| Compound Name | propyl 2-[4-[(2,4-dimethylphenyl)carbamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 5065242 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | propyl 2-[4-[(2,4-dimethylphenyl)carbamoyl]phenoxy]propanoate |
| SMILES | CCCOC(=O)C(C)Oc1ccc(C(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H25NO4/c1-5-12-25-21(24)16(4)26-18-9-7-17(8-10-18)20(23)22-19-11-6-14(2)13-15(19)3/h6-11,13,16H,5,12H2,1-4H3,(H,22,23) |
| InChIKey | YFTMALMFQLHRBQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |