C7H10CuNS2 — CID 506588
copper(1+);4,6,6-trimethyl-1,3-thiazine-2-thiolate (PubChem CID 506588) has the molecular formula C7H10CuNS2 and a molecular weight of 235.84 g/mol. Its IUPAC name is copper(1+);4,6,6-trimethyl-1,3-thiazine-2-thiolate.
| Compound Name | copper(1+);4,6,6-trimethyl-1,3-thiazine-2-thiolate |
|---|---|
| PubChem CID | 506588 |
| Molecular Formula | C7H10CuNS2 |
| Molecular Weight | 235.84 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | copper(1+);4,6,6-trimethyl-1,3-thiazine-2-thiolate |
| SMILES | CC1=CC(C)(C)SC([S-])=N1.[Cu+] |
| InChI | InChI=1S/C7H11NS2.Cu/c1-5-4-7(2,3)10-6(9)8-5;/h4H,1-3H3,(H,8,9);/q;+1/p-1 |
| InChIKey | LWAWAAYKLJZYAM-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.84 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|