C23H23NO8 — CID 5065893
tetramethyl 4a,8-dimethylbenzo[f]quinolizine-1,2,3,4-tetracarboxylate (PubChem CID 5065893) has the molecular formula C23H23NO8 and a molecular weight of 441.44 g/mol. Its IUPAC name is tetramethyl 4a,8-dimethylbenzo[f]quinolizine-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 4a,8-dimethylbenzo[f]quinolizine-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 5065893 |
| Molecular Formula | C23H23NO8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tetramethyl 4a,8-dimethylbenzo[f]quinolizine-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2c3ccc(C)cc3C=CC2(C)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C23H23NO8/c1-12-7-8-14-13(11-12)9-10-23(2)17(21(27)31-5)15(19(25)29-3)16(20(26)30-4)18(24(14)23)22(28)32-6/h7-11H,1-6H3 |
| InChIKey | BCRRAGSAYSEFFS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|