C11H8Cl2O2 — CID 5067256
4,5-dichlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 5067256) has the molecular formula C11H8Cl2O2 and a molecular weight of 243.09 g/mol. Its IUPAC name is 4,5-dichlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | 4,5-dichlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 5067256 |
| Molecular Formula | C11H8Cl2O2 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 4,5-dichlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C11H8Cl2O2/c12-8-9(13)11(15)7-5-2-1-4(3-5)6(7)10(8)14/h1-2,4-7H,3H2 |
| InChIKey | WEGSYDIPZCRXKT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|