About 2,7-dibromo-9,9-dichlorofluorene
2,7-dibromo-9,9-dichlorofluorene (PubChem CID 5067268) has the molecular formula C13H6Br2Cl2
and a molecular weight of 392.91 g/mol. Its IUPAC name is 2,7-dibromo-9,9-dichlorofluorene.
Molecular Properties
| Compound Name | 2,7-dibromo-9,9-dichlorofluorene |
| PubChem CID | 5067268 |
| Molecular Formula | C13H6Br2Cl2 |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 389.82 |
| IUPAC Name | 2,7-dibromo-9,9-dichlorofluorene |
| SMILES | ClC1(Cl)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C13H6Br2Cl2/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16,17)11(9)5-7/h1-6H |
| InChIKey | LGHZLUBSADXXPT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dibromo-9,9-dichlorofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9,9-dichlorofluorene?
The IUPAC name of 2,7-dibromo-9,9-dichlorofluorene (CID 5067268) is 2,7-dibromo-9,9-dichlorofluorene.
What is the SMILES notation for 2,7-dibromo-9,9-dichlorofluorene?
The canonical SMILES for 2,7-dibromo-9,9-dichlorofluorene is ClC1(Cl)c2cc(Br)ccc2-c2ccc(Br)cc21.
What is the InChIKey of 2,7-dibromo-9,9-dichlorofluorene?
The InChIKey is LGHZLUBSADXXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Br2Cl2/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16,17)11(9)5-7/h1-6H.
What are the key properties of 2,7-dibromo-9,9-dichlorofluorene?
2,7-dibromo-9,9-dichlorofluorene has a molecular weight of 392.91 g/mol, XLogP of 5.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9,9-dichlorofluorene is sourced from PubChem (CID 5067268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).