C15H18BrN — CID 5067706
5-bromo-1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 5067706) has the molecular formula C15H18BrN and a molecular weight of 292.22 g/mol. Its IUPAC name is 5-bromo-1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-bromo-1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 5067706 |
| Molecular Formula | C15H18BrN |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-bromo-1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C=CCC1Cc2c(Br)cccc2C(CC=C)N1 |
| InChI | InChI=1S/C15H18BrN/c1-3-6-11-10-13-12(8-5-9-14(13)16)15(17-11)7-4-2/h3-5,8-9,11,15,17H,1-2,6-7,10H2 |
| InChIKey | VKQGKOSWTAPJPJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|