C28H35N3O5 — CID 506774
(2S,4R)-1-[(2S)-2-benzamido-3-methylbutanoyl]-N-[(2S)-1-oxobutan-2-yl]-4-phenylmethoxypyrrolidine-2-carboxamide (PubChem CID 506774) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-benzamido-3-methylbutanoyl]-N-[(2S)-1-oxobutan-2-yl]-4-phenylmethoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-benzamido-3-methylbutanoyl]-N-[(2S)-1-oxobutan-2-yl]-4-phenylmethoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 506774 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-benzamido-3-methylbutanoyl]-N-[(2S)-1-oxobutan-2-yl]-4-phenylmethoxypyrrolidine-2-carboxamide |
| SMILES | CC[C@@H](C=O)NC(=O)[C@@H]1C[C@@H](OCc2ccccc2)CN1C(=O)[C@@H](NC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C28H35N3O5/c1-4-22(17-32)29-27(34)24-15-23(36-18-20-11-7-5-8-12-20)16-31(24)28(35)25(19(2)3)30-26(33)21-13-9-6-10-14-21/h5-14,17,19,22-25H,4,15-16,18H2,1-3H3,(H,29,34)(H,30,33)/t22-,23+,24-,25-/m0/s1 |
| InChIKey | AXLVKGIGVUHTMG-NDBXHCKUSA-N |
| XLogP | 2.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|