pyrrolidine-3,4-dicarboxylic acid

C6H9NO4 — CID 5067945

IUPACpyrrolidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CNCC1C(=O)O
InChIInChI=1S/C6H9NO4/c8-5(9)3-1-7-2-4(3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)
InChIKeyKMHDKGFRYVKQNW-UHFFFAOYSA-N
MW159.14 g/mol
LogP-1.01
Rot. Bonds2

About pyrrolidine-3,4-dicarboxylic acid

pyrrolidine-3,4-dicarboxylic acid (PubChem CID 5067945) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is pyrrolidine-3,4-dicarboxylic acid.

Molecular Properties

Compound Namepyrrolidine-3,4-dicarboxylic acid
PubChem CID5067945
Molecular FormulaC6H9NO4
Molecular Weight159.14 g/mol
Exact Mass159.05
IUPAC Namepyrrolidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CNCC1C(=O)O
InChIInChI=1S/C6H9NO4/c8-5(9)3-1-7-2-4(3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)
InChIKeyKMHDKGFRYVKQNW-UHFFFAOYSA-N
XLogP-1.01
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.14
LogP ≤ 5-1.01
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze pyrrolidine-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrrolidine-3,4-dicarboxylic acid?
The IUPAC name of pyrrolidine-3,4-dicarboxylic acid (CID 5067945) is pyrrolidine-3,4-dicarboxylic acid.
What is the SMILES notation for pyrrolidine-3,4-dicarboxylic acid?
The canonical SMILES for pyrrolidine-3,4-dicarboxylic acid is O=C(O)C1CNCC1C(=O)O.
What is the InChIKey of pyrrolidine-3,4-dicarboxylic acid?
The InChIKey is KMHDKGFRYVKQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO4/c8-5(9)3-1-7-2-4(3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11).
What are the key properties of pyrrolidine-3,4-dicarboxylic acid?
pyrrolidine-3,4-dicarboxylic acid has a molecular weight of 159.14 g/mol, XLogP of -1.01, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-3,4-dicarboxylic acid is sourced from PubChem (CID 5067945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).