About 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one
2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 5069018) has the molecular formula C16H13Cl2NOS
and a molecular weight of 338.26 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
| PubChem CID | 5069018 |
| Molecular Formula | C16H13Cl2NOS |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)CSC2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H13Cl2NOS/c1-10-2-5-12(6-3-10)19-15(20)9-21-16(19)11-4-7-13(17)14(18)8-11/h2-8,16H,9H2,1H3 |
| InChIKey | MBNLXYAWOWEXNU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one (CID 5069018) is 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one is Cc1ccc(N2C(=O)CSC2c2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one?
The InChIKey is MBNLXYAWOWEXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2NOS/c1-10-2-5-12(6-3-10)19-15(20)9-21-16(19)11-4-7-13(17)14(18)8-11/h2-8,16H,9H2,1H3.
What are the key properties of 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one?
2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one has a molecular weight of 338.26 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-3-(4-methylphenyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 5069018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).