About 1-cyclopropylethylurea
1-cyclopropylethylurea (PubChem CID 5069854) has the molecular formula C6H12N2O
and a molecular weight of 128.18 g/mol. Its IUPAC name is 1-cyclopropylethylurea.
Molecular Properties
| Compound Name | 1-cyclopropylethylurea |
| PubChem CID | 5069854 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 1-cyclopropylethylurea |
| SMILES | CC(NC(N)=O)C1CC1 |
| InChI | InChI=1S/C6H12N2O/c1-4(5-2-3-5)8-6(7)9/h4-5H,2-3H2,1H3,(H3,7,8,9) |
| InChIKey | ALVRDJSKGZLKAF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropylethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylethylurea?
The IUPAC name of 1-cyclopropylethylurea (CID 5069854) is 1-cyclopropylethylurea.
What is the SMILES notation for 1-cyclopropylethylurea?
The canonical SMILES for 1-cyclopropylethylurea is CC(NC(N)=O)C1CC1.
What is the InChIKey of 1-cyclopropylethylurea?
The InChIKey is ALVRDJSKGZLKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-4(5-2-3-5)8-6(7)9/h4-5H,2-3H2,1H3,(H3,7,8,9).
What are the key properties of 1-cyclopropylethylurea?
1-cyclopropylethylurea has a molecular weight of 128.18 g/mol, XLogP of 0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylethylurea is sourced from PubChem (CID 5069854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).