About 3-amino-4-chlorophenol
3-amino-4-chlorophenol (PubChem CID 5070078) has the molecular formula C6H6ClNO
and a molecular weight of 143.57 g/mol. Its IUPAC name is 3-amino-4-chlorophenol.
Molecular Properties
| Compound Name | 3-amino-4-chlorophenol |
| PubChem CID | 5070078 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 g/mol |
| Exact Mass | 143.01 |
| IUPAC Name | 3-amino-4-chlorophenol |
| SMILES | Nc1cc(O)ccc1Cl |
| InChI | InChI=1S/C6H6ClNO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,8H2 |
| InChIKey | FWUALUHYKLDYAN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-chlorophenol?
The IUPAC name of 3-amino-4-chlorophenol (CID 5070078) is 3-amino-4-chlorophenol.
What is the SMILES notation for 3-amino-4-chlorophenol?
The canonical SMILES for 3-amino-4-chlorophenol is Nc1cc(O)ccc1Cl.
What is the InChIKey of 3-amino-4-chlorophenol?
The InChIKey is FWUALUHYKLDYAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,8H2.
What are the key properties of 3-amino-4-chlorophenol?
3-amino-4-chlorophenol has a molecular weight of 143.57 g/mol, XLogP of 1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-chlorophenol is sourced from PubChem (CID 5070078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).