C41H54N2O12S — CID 5070217
[3,4,5-triacetyloxy-6-[2-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-2-sulfanylideneethyl]oxan-2-yl]methyl acetate (PubChem CID 5070217) has the molecular formula C41H54N2O12S and a molecular weight of 798.95 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[2-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-2-sulfanylideneethyl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[2-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-2-sulfanylideneethyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 5070217 |
| Molecular Formula | C41H54N2O12S |
| Molecular Weight | 798.95 g/mol |
| Exact Mass | 798.34 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[2-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-2-sulfanylideneethyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(CC(=S)Nc2cccc(C3OC(CN4CCCCCCC4)CC(c4ccc(CO)cc4)O3)c2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C41H54N2O12S/c1-25(45)49-24-36-39(51-27(3)47)40(52-28(4)48)38(50-26(2)46)35(54-36)21-37(56)42-32-12-10-11-31(19-32)41-53-33(22-43-17-8-6-5-7-9-18-43)20-34(55-41)30-15-13-29(23-44)14-16-30/h10-16,19,33-36,38-41,44H,5-9,17-18,20-24H2,1-4H3,(H,42,56) |
| InChIKey | SGKVVCIHIVCFGK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 168.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.95 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|