C14H28N+ — CID 5070234
3,3-diethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane (PubChem CID 5070234) has the molecular formula C14H28N+ and a molecular weight of 210.38 g/mol. Its IUPAC name is 3,3-diethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane.
| Compound Name | 3,3-diethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 5070234 |
| Molecular Formula | C14H28N+ |
| Molecular Weight | 210.38 g/mol |
| Exact Mass | 210.22 |
| IUPAC Name | 3,3-diethyl-1,8,8-trimethyl-3-azoniabicyclo[3.2.1]octane |
| SMILES | CC[N+]1(CC)CC2CCC(C)(C1)C2(C)C |
| InChI | InChI=1S/C14H28N/c1-6-15(7-2)10-12-8-9-14(5,11-15)13(12,3)4/h12H,6-11H2,1-5H3/q+1 |
| InChIKey | AJYXEKAMHHRQSR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|