C17H7Cl2F5N2O2 — CID 5070431
3-(2,6-dichlorophenyl)-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-4-carboxamide (PubChem CID 5070431) has the molecular formula C17H7Cl2F5N2O2 and a molecular weight of 437.15 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,6-dichlorophenyl)-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 5070431 |
| Molecular Formula | C17H7Cl2F5N2O2 |
| Molecular Weight | 437.15 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H7Cl2F5N2O2/c1-5-8(15(26-28-5)9-6(18)3-2-4-7(9)19)17(27)25-16-13(23)11(21)10(20)12(22)14(16)24/h2-4H,1H3,(H,25,27) |
| InChIKey | AMQLBQGWMBHONN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.15 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|