About 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one
3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 5071375) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one |
| PubChem CID | 5071375 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | CCCCn1cnc2c(oc3ccccc32)c1=O |
| InChI | InChI=1S/C14H14N2O2/c1-2-3-8-16-9-15-12-10-6-4-5-7-11(10)18-13(12)14(16)17/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | ZZZMUKMURDIYLU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one (CID 5071375) is 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one is CCCCn1cnc2c(oc3ccccc32)c1=O.
What is the InChIKey of 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one?
The InChIKey is ZZZMUKMURDIYLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2/c1-2-3-8-16-9-15-12-10-6-4-5-7-11(10)18-13(12)14(16)17/h4-7,9H,2-3,8H2,1H3.
What are the key properties of 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one?
3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one has a molecular weight of 242.28 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-[1]benzofuro[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 5071375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).