About ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate
ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate (PubChem CID 5072317) has the molecular formula C18H16ClNO4
and a molecular weight of 345.78 g/mol. Its IUPAC name is ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate |
| PubChem CID | 5072317 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n(-c3ccc(Cl)cc3)c1=O)CCCC2=O |
| InChI | InChI=1S/C18H16ClNO4/c1-2-24-18(23)14-10-13-15(4-3-5-16(13)21)20(17(14)22)12-8-6-11(19)7-9-12/h6-10H,2-5H2,1H3 |
| InChIKey | SOSMNDPLNAADOJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
The IUPAC name of ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate (CID 5072317) is ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate.
What is the SMILES notation for ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
The canonical SMILES for ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate is CCOC(=O)c1cc2c(n(-c3ccc(Cl)cc3)c1=O)CCCC2=O.
What is the InChIKey of ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
The InChIKey is SOSMNDPLNAADOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClNO4/c1-2-24-18(23)14-10-13-15(4-3-5-16(13)21)20(17(14)22)12-8-6-11(19)7-9-12/h6-10H,2-5H2,1H3.
What are the key properties of ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate?
ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate has a molecular weight of 345.78 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(4-chlorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxylate is sourced from PubChem (CID 5072317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).