C17H20N2O4 — CID 5072859
N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-2-ethoxybenzamide (PubChem CID 5072859) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-2-ethoxybenzamide.
| Compound Name | N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 5072859 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C17H20N2O4/c1-2-23-14-10-6-5-9-13(14)15(20)18-19-16(21)11-7-3-4-8-12(11)17(19)22/h5-6,9-12H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | VRLISDJAFUYKAP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|