About 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide
3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 5072962) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
| PubChem CID | 5072962 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=CC(N2CCCCCC2)C1 |
| InChI | InChI=1S/C10H17NO2S/c12-14(13)8-5-10(9-14)11-6-3-1-2-4-7-11/h5,8,10H,1-4,6-7,9H2 |
| InChIKey | MTKJCHWTANGGGP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide (CID 5072962) is 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide is O=S1(=O)C=CC(N2CCCCCC2)C1.
What is the InChIKey of 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
The InChIKey is MTKJCHWTANGGGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c12-14(13)8-5-10(9-14)11-6-3-1-2-4-7-11/h5,8,10H,1-4,6-7,9H2.
What are the key properties of 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide?
3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide has a molecular weight of 215.32 g/mol, XLogP of 1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azepan-1-yl)-2,3-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 5072962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).