About N-butan-2-yl-3,4-dimethoxybenzenesulfonamide
N-butan-2-yl-3,4-dimethoxybenzenesulfonamide (PubChem CID 5073030) has the molecular formula C12H19NO4S
and a molecular weight of 273.35 g/mol. Its IUPAC name is N-butan-2-yl-3,4-dimethoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-3,4-dimethoxybenzenesulfonamide |
| PubChem CID | 5073030 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-butan-2-yl-3,4-dimethoxybenzenesulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO4S/c1-5-9(2)13-18(14,15)10-6-7-11(16-3)12(8-10)17-4/h6-9,13H,5H2,1-4H3 |
| InChIKey | QXKJFAONGHTPPZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butan-2-yl-3,4-dimethoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3,4-dimethoxybenzenesulfonamide?
The IUPAC name of N-butan-2-yl-3,4-dimethoxybenzenesulfonamide (CID 5073030) is N-butan-2-yl-3,4-dimethoxybenzenesulfonamide.
What is the SMILES notation for N-butan-2-yl-3,4-dimethoxybenzenesulfonamide?
The canonical SMILES for N-butan-2-yl-3,4-dimethoxybenzenesulfonamide is CCC(C)NS(=O)(=O)c1ccc(OC)c(OC)c1.
What is the InChIKey of N-butan-2-yl-3,4-dimethoxybenzenesulfonamide?
The InChIKey is QXKJFAONGHTPPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO4S/c1-5-9(2)13-18(14,15)10-6-7-11(16-3)12(8-10)17-4/h6-9,13H,5H2,1-4H3.
What are the key properties of N-butan-2-yl-3,4-dimethoxybenzenesulfonamide?
N-butan-2-yl-3,4-dimethoxybenzenesulfonamide has a molecular weight of 273.35 g/mol, XLogP of 1.78, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3,4-dimethoxybenzenesulfonamide is sourced from PubChem (CID 5073030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).