C12H16O3 — CID 5073341
5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 5073341) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 5073341 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | COc1ccc(OC)c2c1CCC(O)C2 |
| InChI | InChI=1S/C12H16O3/c1-14-11-5-6-12(15-2)10-7-8(13)3-4-9(10)11/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | PYKAZTXRZOPYIQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |