About 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one
3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one (PubChem CID 5073343) has the molecular formula C22H18O5
and a molecular weight of 362.38 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one.
Molecular Properties
| Compound Name | 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one |
| PubChem CID | 5073343 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one |
| SMILES | COc1cc(-c2cc(=O)c3c(ccc4ccccc43)o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H18O5/c1-24-19-10-14(11-20(25-2)22(19)26-3)18-12-16(23)21-15-7-5-4-6-13(15)8-9-17(21)27-18/h4-12H,1-3H3 |
| InChIKey | HXRGYQMZSNYIEW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one?
The IUPAC name of 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one (CID 5073343) is 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one.
What is the SMILES notation for 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one?
The canonical SMILES for 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one is COc1cc(-c2cc(=O)c3c(ccc4ccccc43)o2)cc(OC)c1OC.
What is the InChIKey of 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one?
The InChIKey is HXRGYQMZSNYIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O5/c1-24-19-10-14(11-20(25-2)22(19)26-3)18-12-16(23)21-15-7-5-4-6-13(15)8-9-17(21)27-18/h4-12H,1-3H3.
What are the key properties of 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one?
3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one has a molecular weight of 362.38 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4,5-trimethoxyphenyl)benzo[f]chromen-1-one is sourced from PubChem (CID 5073343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).