C21H21N3O4S2 — CID 50739824
(5Z)-5-(furan-2-ylmethylidene)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50739824) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is (5Z)-5-(furan-2-ylmethylidene)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(furan-2-ylmethylidene)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50739824 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | (5Z)-5-(furan-2-ylmethylidene)-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2CCN(C(=O)CN3C(=O)/C(=C/c4ccco4)SC3=S)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O4S2/c1-27-16-6-4-15(5-7-16)22-8-10-23(11-9-22)19(25)14-24-20(26)18(30-21(24)29)13-17-3-2-12-28-17/h2-7,12-13H,8-11,14H2,1H3/b18-13- |
| InChIKey | SEUMMKNMUSIQHF-AQTBWJFISA-N |
| XLogP | 2.84 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|