C21H30N2O3S — CID 50740151
4-[1-(2,6-dimethylpiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 50740151) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is 4-[1-(2,6-dimethylpiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[1-(2,6-dimethylpiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 50740151 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 4-[1-(2,6-dimethylpiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CSCCC(C(=O)N1C(C)CCCC1C)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C21H30N2O3S/c1-12-5-4-6-13(2)22(12)19(24)16(9-10-27-3)23-20(25)17-14-7-8-15(11-14)18(17)21(23)26/h7-8,12-18H,4-6,9-11H2,1-3H3 |
| InChIKey | IIBFPBQSWOSRIN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|