About 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide
2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide (PubChem CID 5074062) has the molecular formula C25H30N4O2
and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide |
| PubChem CID | 5074062 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C(=O)NCCCN3CCOCC3)c3ccccc3n2)cc1C |
| InChI | InChI=1S/C25H30N4O2/c1-18-8-9-20(16-19(18)2)27-24-17-22(21-6-3-4-7-23(21)28-24)25(30)26-10-5-11-29-12-14-31-15-13-29/h3-4,6-9,16-17H,5,10-15H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | MNZOCJMWOOFZRF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide?
The IUPAC name of 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide (CID 5074062) is 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide.
What is the SMILES notation for 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide?
The canonical SMILES for 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide is Cc1ccc(Nc2cc(C(=O)NCCCN3CCOCC3)c3ccccc3n2)cc1C.
What is the InChIKey of 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide?
The InChIKey is MNZOCJMWOOFZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N4O2/c1-18-8-9-20(16-19(18)2)27-24-17-22(21-6-3-4-7-23(21)28-24)25(30)26-10-5-11-29-12-14-31-15-13-29/h3-4,6-9,16-17H,5,10-15H2,1-2H3,(H,26,30)(H,27,28).
What are the key properties of 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide?
2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide has a molecular weight of 418.54 g/mol, XLogP of 4.05, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylanilino)-N-(3-morpholin-4-ylpropyl)quinoline-4-carboxamide is sourced from PubChem (CID 5074062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).