About 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane
3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane (PubChem CID 50741626) has the molecular formula C11H19Cl
and a molecular weight of 186.73 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane |
| PubChem CID | 50741626 |
| Molecular Formula | C11H19Cl |
| Molecular Weight | 186.73 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)C2CCC(C2)C1CCCl |
| InChI | InChI=1S/C11H19Cl/c1-11(2)9-4-3-8(7-9)10(11)5-6-12/h8-10H,3-7H2,1-2H3 |
| InChIKey | SNSQXHDDJMEBRL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane?
The IUPAC name of 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane (CID 50741626) is 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane.
What is the SMILES notation for 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane?
The canonical SMILES for 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane is CC1(C)C2CCC(C2)C1CCCl.
What is the InChIKey of 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane?
The InChIKey is SNSQXHDDJMEBRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19Cl/c1-11(2)9-4-3-8(7-9)10(11)5-6-12/h8-10H,3-7H2,1-2H3.
What are the key properties of 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane?
3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane has a molecular weight of 186.73 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloroethyl)-2,2-dimethylbicyclo[2.2.1]heptane is sourced from PubChem (CID 50741626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).