C11H11INO2+ — CID 50741825
6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide (PubChem CID 50741825) has the molecular formula C11H11INO2+ and a molecular weight of 316.12 g/mol. Its IUPAC name is 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide.
| Compound Name | 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide |
|---|---|
| PubChem CID | 50741825 |
| Molecular Formula | C11H11INO2+ |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide |
| SMILES | C[n+]1ccc2cc3c(cc2c1)OCO3.I |
| InChI | InChI=1S/C11H10NO2.HI/c1-12-3-2-8-4-10-11(14-7-13-10)5-9(8)6-12;/h2-6H,7H2,1H3;1H/q+1; |
| InChIKey | BAKKYYKTHHIZOE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|