About 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide
6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide (PubChem CID 50741825) has the molecular formula C11H11INO2+
and a molecular weight of 316.12 g/mol. Its IUPAC name is 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide.
Molecular Properties
| Compound Name | 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide |
| PubChem CID | 50741825 |
| Molecular Formula | C11H11INO2+ |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide |
| SMILES | C[n+]1ccc2cc3c(cc2c1)OCO3.I |
| InChI | InChI=1S/C11H10NO2.HI/c1-12-3-2-8-4-10-11(14-7-13-10)5-9(8)6-12;/h2-6H,7H2,1H3;1H/q+1; |
| InChIKey | BAKKYYKTHHIZOE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide?
The IUPAC name of 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide (CID 50741825) is 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide.
What is the SMILES notation for 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide?
The canonical SMILES for 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide is C[n+]1ccc2cc3c(cc2c1)OCO3.I.
What is the InChIKey of 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide?
The InChIKey is BAKKYYKTHHIZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10NO2.HI/c1-12-3-2-8-4-10-11(14-7-13-10)5-9(8)6-12;/h2-6H,7H2,1H3;1H/q+1;.
What are the key properties of 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide?
6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide has a molecular weight of 316.12 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1,3]dioxolo[4,5-g]isoquinolin-6-ium;hydroiodide is sourced from PubChem (CID 50741825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).