C12H3F15O3 — CID 50742090
1,3,5-tris(1,1,2,2,2-pentafluoroethoxy)benzene (PubChem CID 50742090) has the molecular formula C12H3F15O3 and a molecular weight of 480.12 g/mol. Its IUPAC name is 1,3,5-tris(1,1,2,2,2-pentafluoroethoxy)benzene.
| Compound Name | 1,3,5-tris(1,1,2,2,2-pentafluoroethoxy)benzene |
|---|---|
| PubChem CID | 50742090 |
| Molecular Formula | C12H3F15O3 |
| Molecular Weight | 480.12 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | 1,3,5-tris(1,1,2,2,2-pentafluoroethoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)Oc1cc(OC(F)(F)C(F)(F)F)cc(OC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H3F15O3/c13-7(14,15)10(22,23)28-4-1-5(29-11(24,25)8(16,17)18)3-6(2-4)30-12(26,27)9(19,20)21/h1-3H |
| InChIKey | QQITYGDYPFZPRU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.12 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|